C8H15N — CID 91053925
2,5-dimethyl-3H-pyrrole;ethane (PubChem CID 91053925) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is 2,5-dimethyl-3H-pyrrole;ethane.
| Compound Name | 2,5-dimethyl-3H-pyrrole;ethane |
|---|---|
| PubChem CID | 91053925 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 2,5-dimethyl-3H-pyrrole;ethane |
| SMILES | CC.CC1=CCC(C)=N1 |
| InChI | InChI=1S/C6H9N.C2H6/c1-5-3-4-6(2)7-5;1-2/h3H,4H2,1-2H3;1-2H3 |
| InChIKey | WTJGEMFXKJSADG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |