C11H15NS — CID 123642712
6-butylidene-N-methylsulfanylcyclohexa-2,4-dien-1-imine (PubChem CID 123642712) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 6-butylidene-N-methylsulfanylcyclohexa-2,4-dien-1-imine.
| Compound Name | 6-butylidene-N-methylsulfanylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123642712 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-butylidene-N-methylsulfanylcyclohexa-2,4-dien-1-imine |
| SMILES | CCCC=C1C=CC=CC1=NSC |
| InChI | InChI=1S/C11H15NS/c1-3-4-7-10-8-5-6-9-11(10)12-13-2/h5-9H,3-4H2,1-2H3 |
| InChIKey | XLSYIBOLTAQVCV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|