C42H45FN2 — CID 123643523
4-[[6-(3-fluoro-2-pyridinyl)-1,4,4-trimethyl-2,3-dihydronaphthalen-1-yl]methyl]-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)isoquinoline (PubChem CID 123643523) has the molecular formula C42H45FN2 and a molecular weight of 596.83 g/mol. Its IUPAC name is 4-[[6-(3-fluoro-2-pyridinyl)-1,4,4-trimethyl-2,3-dihydronaphthalen-1-yl]methyl]-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)isoquinoline.
| Compound Name | 4-[[6-(3-fluoro-2-pyridinyl)-1,4,4-trimethyl-2,3-dihydronaphthalen-1-yl]methyl]-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)isoquinoline |
|---|---|
| PubChem CID | 123643523 |
| Molecular Formula | C42H45FN2 |
| Molecular Weight | 596.83 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | 4-[[6-(3-fluoro-2-pyridinyl)-1,4,4-trimethyl-2,3-dihydronaphthalen-1-yl]methyl]-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)isoquinoline |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3ncc(CC4(C)CCC(C)(C)c5cc(-c6ncccc6F)ccc54)c4ccccc34)ccc21 |
| InChI | InChI=1S/C42H45FN2/c1-39(2)18-19-40(3,4)34-23-27(14-16-32(34)39)37-31-12-9-8-11-30(31)29(26-45-37)25-42(7)21-20-41(5,6)35-24-28(15-17-33(35)42)38-36(43)13-10-22-44-38/h8-17,22-24,26H,18-21,25H2,1-7H3 |
| InChIKey | JYNRIIMOYNJFDL-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.83 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |