C42H80O7 — CID 123643635
(2R)-2-octadec-9-enoxy-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]icos-11-enoic acid (PubChem CID 123643635) has the molecular formula C42H80O7 and a molecular weight of 697.09 g/mol. Its IUPAC name is (2R)-2-octadec-9-enoxy-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]icos-11-enoic acid.
| Compound Name | (2R)-2-octadec-9-enoxy-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]icos-11-enoic acid |
|---|---|
| PubChem CID | 123643635 |
| Molecular Formula | C42H80O7 |
| Molecular Weight | 697.09 g/mol |
| Exact Mass | 696.59 |
| IUPAC Name | (2R)-2-octadec-9-enoxy-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]icos-11-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCCO[C@@](CCCCCCCCC=CCCCCCCCC)(C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C42H80O7/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-42(41(47)48,40(46)39(45)38(44)37-43)49-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,38-40,43-46H,3-16,21-37H2,1-2H3,(H,47,48)/t38-,39-,40+,42-/m1/s1 |
| InChIKey | WUTFWNGHHNUSOS-ZMASXJBXSA-N |
| XLogP | 10.37 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.09 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|