C19H19F3N4O — CID 123643874
[6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-4-yl]-[4-fluoro-3-(1-methylcyclopropyl)oxyphenyl]methanimine (PubChem CID 123643874) has the molecular formula C19H19F3N4O and a molecular weight of 376.38 g/mol. Its IUPAC name is [6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-4-yl]-[4-fluoro-3-(1-methylcyclopropyl)oxyphenyl]methanimine.
| Compound Name | [6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-4-yl]-[4-fluoro-3-(1-methylcyclopropyl)oxyphenyl]methanimine |
|---|---|
| PubChem CID | 123643874 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-4-yl]-[4-fluoro-3-(1-methylcyclopropyl)oxyphenyl]methanimine |
| SMILES | [H]/N=C(/c1ccc(F)c(OC2(C)CC2)c1)c1cc(N2CCC(F)(F)C2)ncn1 |
| InChI | InChI=1S/C19H19F3N4O/c1-18(4-5-18)27-15-8-12(2-3-13(15)20)17(23)14-9-16(25-11-24-14)26-7-6-19(21,22)10-26/h2-3,8-9,11,23H,4-7,10H2,1H3/b23-17- |
| InChIKey | AFIAHFJEKWYQKN-QJOMJCCJSA-N |
| XLogP | 3.81 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|