C12H20N3O3S+ — CID 123646359
[2-(5-acetylsulfanyl-1-methylimidazol-4-yl)-1-carboxyethyl]-trimethylazanium (PubChem CID 123646359) has the molecular formula C12H20N3O3S+ and a molecular weight of 286.38 g/mol. Its IUPAC name is [2-(5-acetylsulfanyl-1-methylimidazol-4-yl)-1-carboxyethyl]-trimethylazanium.
| Compound Name | [2-(5-acetylsulfanyl-1-methylimidazol-4-yl)-1-carboxyethyl]-trimethylazanium |
|---|---|
| PubChem CID | 123646359 |
| Molecular Formula | C12H20N3O3S+ |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [2-(5-acetylsulfanyl-1-methylimidazol-4-yl)-1-carboxyethyl]-trimethylazanium |
| SMILES | CC(=O)Sc1c(CC(C(=O)O)[N+](C)(C)C)ncn1C |
| InChI | InChI=1S/C12H19N3O3S/c1-8(16)19-11-9(13-7-14(11)2)6-10(12(17)18)15(3,4)5/h7,10H,6H2,1-5H3/p+1 |
| InChIKey | XSNJORYJGGCLFS-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|