C14H18IN2O2+ — CID 11783636
[(1S)-1-carboxy-2-(7-iodo-1H-indol-3-yl)ethyl]-trimethylazanium (PubChem CID 11783636) has the molecular formula C14H18IN2O2+ and a molecular weight of 373.21 g/mol. Its IUPAC name is [(1S)-1-carboxy-2-(7-iodo-1H-indol-3-yl)ethyl]-trimethylazanium.
| Compound Name | [(1S)-1-carboxy-2-(7-iodo-1H-indol-3-yl)ethyl]-trimethylazanium |
|---|---|
| PubChem CID | 11783636 |
| Molecular Formula | C14H18IN2O2+ |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | [(1S)-1-carboxy-2-(7-iodo-1H-indol-3-yl)ethyl]-trimethylazanium |
| SMILES | C[N+](C)(C)[C@@H](Cc1c[nH]c2c(I)cccc12)C(=O)O |
| InChI | InChI=1S/C14H17IN2O2/c1-17(2,3)12(14(18)19)7-9-8-16-13-10(9)5-4-6-11(13)15/h4-6,8,12,16H,7H2,1-3H3/p+1/t12-/m0/s1 |
| InChIKey | MCEBBCIJDLGHBS-LBPRGKRZSA-O |
| XLogP | 2.47 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|