C14H16I2N2O2 — CID 76764121
(2R)-3-(5,6-diiodo-1H-indol-3-yl)-2-(trimethylazaniumyl)propanoate (PubChem CID 76764121) has the molecular formula C14H16I2N2O2 and a molecular weight of 498.10 g/mol. Its IUPAC name is (2R)-3-(5,6-diiodo-1H-indol-3-yl)-2-(trimethylazaniumyl)propanoate.
| Compound Name | (2R)-3-(5,6-diiodo-1H-indol-3-yl)-2-(trimethylazaniumyl)propanoate |
|---|---|
| PubChem CID | 76764121 |
| Molecular Formula | C14H16I2N2O2 |
| Molecular Weight | 498.10 g/mol |
| Exact Mass | 497.93 |
| IUPAC Name | (2R)-3-(5,6-diiodo-1H-indol-3-yl)-2-(trimethylazaniumyl)propanoate |
| SMILES | C[N+](C)(C)[C@H](Cc1c[nH]c2cc(I)c(I)cc12)C(=O)[O-] |
| InChI | InChI=1S/C14H16I2N2O2/c1-18(2,3)13(14(19)20)4-8-7-17-12-6-11(16)10(15)5-9(8)12/h5-7,13,17H,4H2,1-3H3/t13-/m1/s1 |
| InChIKey | AAQRZBVHHHZEHA-CYBMUJFWSA-N |
| XLogP | 1.74 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.10 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|