C26H36O4 — CID 123646626
ethyl 3-[(2R,10R,14S,15S,16S,18S)-15-hydroxy-10,14-dimethyl-7-oxo-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-4-enyl]propanoate (PubChem CID 123646626) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is ethyl 3-[(2R,10R,14S,15S,16S,18S)-15-hydroxy-10,14-dimethyl-7-oxo-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-4-enyl]propanoate.
| Compound Name | ethyl 3-[(2R,10R,14S,15S,16S,18S)-15-hydroxy-10,14-dimethyl-7-oxo-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-4-enyl]propanoate |
|---|---|
| PubChem CID | 123646626 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | ethyl 3-[(2R,10R,14S,15S,16S,18S)-15-hydroxy-10,14-dimethyl-7-oxo-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-4-enyl]propanoate |
| SMILES | CCOC(=O)CC[C@]1(O)[C@H]2CC2C2C3C(CC[C@@]21C)[C@@]1(C)CCC(=O)CC1=C1C[C@@H]13 |
| InChI | InChI=1S/C26H36O4/c1-4-30-21(28)7-10-26(29)20-13-17(20)23-22-16-12-15(16)19-11-14(27)5-8-24(19,2)18(22)6-9-25(23,26)3/h16-18,20,22-23,29H,4-13H2,1-3H3/t16-,17?,18?,20-,22?,23?,24+,25-,26-/m0/s1 |
| InChIKey | UYWFZDZSXYGVKQ-GDJJDUTJSA-N |
| XLogP | 4.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|