C14H22O3S — CID 123647388
3-butan-2-yl-1,1-dioxo-4-pent-3-en-2-yl-2H-thiopyran-5-one (PubChem CID 123647388) has the molecular formula C14H22O3S and a molecular weight of 270.39 g/mol. Its IUPAC name is 3-butan-2-yl-1,1-dioxo-4-pent-3-en-2-yl-2H-thiopyran-5-one.
| Compound Name | 3-butan-2-yl-1,1-dioxo-4-pent-3-en-2-yl-2H-thiopyran-5-one |
|---|---|
| PubChem CID | 123647388 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 3-butan-2-yl-1,1-dioxo-4-pent-3-en-2-yl-2H-thiopyran-5-one |
| SMILES | CC=CC(C)C1=C(C(C)CC)CS(=O)(=O)CC1=O |
| InChI | InChI=1S/C14H22O3S/c1-5-7-11(4)14-12(10(3)6-2)8-18(16,17)9-13(14)15/h5,7,10-11H,6,8-9H2,1-4H3 |
| InChIKey | WROMDHPXVZXBOL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|