C11H16O3S — CID 123520612
4-ethyl-1,1-dioxo-5-pent-2-en-3-ylthiophen-3-one (PubChem CID 123520612) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is 4-ethyl-1,1-dioxo-5-pent-2-en-3-ylthiophen-3-one.
| Compound Name | 4-ethyl-1,1-dioxo-5-pent-2-en-3-ylthiophen-3-one |
|---|---|
| PubChem CID | 123520612 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4-ethyl-1,1-dioxo-5-pent-2-en-3-ylthiophen-3-one |
| SMILES | CC=C(CC)C1=C(CC)C(=O)CS1(=O)=O |
| InChI | InChI=1S/C11H16O3S/c1-4-8(5-2)11-9(6-3)10(12)7-15(11,13)14/h4H,5-7H2,1-3H3 |
| InChIKey | FHOJDEDIRLWANN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |