C9H16Si — CID 123647541
(2,3-dimethylcyclopenta-1,3-dien-1-yl)-dimethylsilane (PubChem CID 123647541) has the molecular formula C9H16Si and a molecular weight of 152.31 g/mol. Its IUPAC name is (2,3-dimethylcyclopenta-1,3-dien-1-yl)-dimethylsilane.
| Compound Name | (2,3-dimethylcyclopenta-1,3-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 123647541 |
| Molecular Formula | C9H16Si |
| Molecular Weight | 152.31 g/mol |
| Exact Mass | 152.10 |
| IUPAC Name | (2,3-dimethylcyclopenta-1,3-dien-1-yl)-dimethylsilane |
| SMILES | CC1=CCC([SiH](C)C)=C1C |
| InChI | InChI=1S/C9H16Si/c1-7-5-6-9(8(7)2)10(3)4/h5,10H,6H2,1-4H3 |
| InChIKey | UCOHJVFLBSBFHE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|