C9H16FN — CID 123648017
4-fluoro-4,5-dimethylcycloheptan-1-imine (PubChem CID 123648017) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is 4-fluoro-4,5-dimethylcycloheptan-1-imine.
| Compound Name | 4-fluoro-4,5-dimethylcycloheptan-1-imine |
|---|---|
| PubChem CID | 123648017 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 4-fluoro-4,5-dimethylcycloheptan-1-imine |
| SMILES | [H]/N=C1\CCC(C)C(C)(F)CC1 |
| InChI | InChI=1S/C9H16FN/c1-7-3-4-8(11)5-6-9(7,2)10/h7,11H,3-6H2,1-2H3/b11-8+ |
| InChIKey | JJUVEMNCHXOPEI-DHZHZOJOSA-N |
| XLogP | 2.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|