C32H32N4 — CID 123649413
8-(4a,8a-dihydronaphthalen-1-yl)-2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-1,4,5,6,7,10-hexahydropyrimido[4,5-f]quinazoline (PubChem CID 123649413) has the molecular formula C32H32N4 and a molecular weight of 472.64 g/mol. Its IUPAC name is 8-(4a,8a-dihydronaphthalen-1-yl)-2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-1,4,5,6,7,10-hexahydropyrimido[4,5-f]quinazoline.
| Compound Name | 8-(4a,8a-dihydronaphthalen-1-yl)-2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-1,4,5,6,7,10-hexahydropyrimido[4,5-f]quinazoline |
|---|---|
| PubChem CID | 123649413 |
| Molecular Formula | C32H32N4 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 8-(4a,8a-dihydronaphthalen-1-yl)-2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-1,4,5,6,7,10-hexahydropyrimido[4,5-f]quinazoline |
| SMILES | C1=CCC(C2N=C(C3=CCCC=C3)NC3=C2CCC2=C3CN=C(C3=CC=CC4C=CC=CC34)N2)C=C1 |
| InChI | InChI=1S/C32H32N4/c1-3-11-22(12-4-1)29-26-18-19-28-27(30(26)36-31(35-29)23-13-5-2-6-14-23)20-33-32(34-28)25-17-9-15-21-10-7-8-16-24(21)25/h1,3-5,7-11,13-17,21-22,24,29H,2,6,12,18-20H2,(H,33,34)(H,35,36) |
| InChIKey | XRDZSHIEKCMXCN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |