C24H27FN4O2 — CID 123649482
3-[(2-amino-4-methyl-6-oxo-4-prop-1-en-2-yl-5H-pyrimidin-1-yl)methyl]-4-fluoro-N-(1-phenylethyl)benzamide (PubChem CID 123649482) has the molecular formula C24H27FN4O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is 3-[(2-amino-4-methyl-6-oxo-4-prop-1-en-2-yl-5H-pyrimidin-1-yl)methyl]-4-fluoro-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[(2-amino-4-methyl-6-oxo-4-prop-1-en-2-yl-5H-pyrimidin-1-yl)methyl]-4-fluoro-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 123649482 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 3-[(2-amino-4-methyl-6-oxo-4-prop-1-en-2-yl-5H-pyrimidin-1-yl)methyl]-4-fluoro-N-(1-phenylethyl)benzamide |
| SMILES | C=C(C)C1(C)CC(=O)N(Cc2cc(C(=O)NC(C)c3ccccc3)ccc2F)C(N)=N1 |
| InChI | InChI=1S/C24H27FN4O2/c1-15(2)24(4)13-21(30)29(23(26)28-24)14-19-12-18(10-11-20(19)25)22(31)27-16(3)17-8-6-5-7-9-17/h5-12,16H,1,13-14H2,2-4H3,(H2,26,28)(H,27,31) |
| InChIKey | WHODXPOLRUZISR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|