C24H32F2O4 — CID 123650695
4-[(3S,5aR,6R,7R,8aS)-6-(3,3-difluoro-5-phenylpent-1-enyl)-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid (PubChem CID 123650695) has the molecular formula C24H32F2O4 and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-[(3S,5aR,6R,7R,8aS)-6-(3,3-difluoro-5-phenylpent-1-enyl)-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid.
| Compound Name | 4-[(3S,5aR,6R,7R,8aS)-6-(3,3-difluoro-5-phenylpent-1-enyl)-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 123650695 |
| Molecular Formula | C24H32F2O4 |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 4-[(3S,5aR,6R,7R,8aS)-6-(3,3-difluoro-5-phenylpent-1-enyl)-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@H]1CC[C@@H]2[C@@H](C=CC(F)(F)CCc3ccccc3)[C@H](O)C[C@@H]2OC1 |
| InChI | InChI=1S/C24H32F2O4/c25-24(26,13-11-17-5-2-1-3-6-17)14-12-19-20-10-9-18(7-4-8-23(28)29)16-30-22(20)15-21(19)27/h1-3,5-6,12,14,18-22,27H,4,7-11,13,15-16H2,(H,28,29)/t18-,19+,20+,21+,22-/m0/s1 |
| InChIKey | UNRXLLZEMIYCSS-POHUPDAJSA-N |
| XLogP | 4.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|