C25H40F2O4 — CID 140622779
methyl 4-[(3S,5aR,6R,7R,8aS)-6-[(E)-5-cyclohexyl-3,3-difluoropent-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate (PubChem CID 140622779) has the molecular formula C25H40F2O4 and a molecular weight of 442.59 g/mol. Its IUPAC name is methyl 4-[(3S,5aR,6R,7R,8aS)-6-[(E)-5-cyclohexyl-3,3-difluoropent-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate.
| Compound Name | methyl 4-[(3S,5aR,6R,7R,8aS)-6-[(E)-5-cyclohexyl-3,3-difluoropent-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate |
|---|---|
| PubChem CID | 140622779 |
| Molecular Formula | C25H40F2O4 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | methyl 4-[(3S,5aR,6R,7R,8aS)-6-[(E)-5-cyclohexyl-3,3-difluoropent-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate |
| SMILES | COC(=O)CCC[C@H]1CC[C@@H]2[C@@H](/C=C/C(F)(F)CCC3CCCCC3)[C@H](O)C[C@@H]2OC1 |
| InChI | InChI=1S/C25H40F2O4/c1-30-24(29)9-5-8-19-10-11-21-20(22(28)16-23(21)31-17-19)13-15-25(26,27)14-12-18-6-3-2-4-7-18/h13,15,18-23,28H,2-12,14,16-17H2,1H3/b15-13+/t19-,20+,21+,22+,23-/m0/s1 |
| InChIKey | RGXNRYUOHKLVHU-CEQAYUCLSA-N |
| XLogP | 5.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|