C23H30FN3O2S — CID 123651140
S-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl] 3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbothioate (PubChem CID 123651140) has the molecular formula C23H30FN3O2S and a molecular weight of 431.58 g/mol. Its IUPAC name is S-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl] 3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbothioate.
| Compound Name | S-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl] 3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbothioate |
|---|---|
| PubChem CID | 123651140 |
| Molecular Formula | C23H30FN3O2S |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | S-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl] 3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbothioate |
| SMILES | O=C(CCSC(=O)N1CCCC2CCCC=C21)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H30FN3O2S/c24-19-8-2-4-10-21(19)25-13-15-26(16-14-25)22(28)11-17-30-23(29)27-12-5-7-18-6-1-3-9-20(18)27/h2,4,8-10,18H,1,3,5-7,11-17H2 |
| InChIKey | VDTVBUZCAQTVSL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|