C15H16N6 — CID 123651554
4-(6-aminopyridine-2-carboximidoyl)-6-(1-iminobut-2-en-2-yl)pyridin-3-amine (PubChem CID 123651554) has the molecular formula C15H16N6 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-(6-aminopyridine-2-carboximidoyl)-6-(1-iminobut-2-en-2-yl)pyridin-3-amine.
| Compound Name | 4-(6-aminopyridine-2-carboximidoyl)-6-(1-iminobut-2-en-2-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 123651554 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-(6-aminopyridine-2-carboximidoyl)-6-(1-iminobut-2-en-2-yl)pyridin-3-amine |
| SMILES | [H]/N=C(\c1cccc(N)n1)c1cc(C(=CC)/C=N/[H])ncc1N |
| InChI | InChI=1S/C15H16N6/c1-2-9(7-16)13-6-10(11(17)8-20-13)15(19)12-4-3-5-14(18)21-12/h2-8,16,19H,17H2,1H3,(H2,18,21)/b9-2?,16-7+,19-15- |
| InChIKey | DFSNAJPLAWRMDH-HEURDGIBSA-N |
| XLogP | 2.11 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|