C8H9IN4 — CID 135254602
6-[(Z)-1-iminobut-2-en-2-yl]-N-iodopyrimidin-4-amine (PubChem CID 135254602) has the molecular formula C8H9IN4 and a molecular weight of 288.09 g/mol. Its IUPAC name is 6-[(Z)-1-iminobut-2-en-2-yl]-N-iodopyrimidin-4-amine.
| Compound Name | 6-[(Z)-1-iminobut-2-en-2-yl]-N-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 135254602 |
| Molecular Formula | C8H9IN4 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 6-[(Z)-1-iminobut-2-en-2-yl]-N-iodopyrimidin-4-amine |
| SMILES | [H]/N=C/C(=C\C)c1cc(NI)ncn1 |
| InChI | InChI=1S/C8H9IN4/c1-2-6(4-10)7-3-8(13-9)12-5-11-7/h2-5,10H,1H3,(H,11,12,13)/b6-2+,10-4+ |
| InChIKey | QEIDWIDKFRJTKD-ODCMHONUSA-N |
| XLogP | 2.29 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|