C12H19N5 — CID 174558943
N-cyclopropyl-6-[(3R)-3-(methylamino)butanimidoyl]pyrimidin-4-amine (PubChem CID 174558943) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is N-cyclopropyl-6-[(3R)-3-(methylamino)butanimidoyl]pyrimidin-4-amine.
| Compound Name | N-cyclopropyl-6-[(3R)-3-(methylamino)butanimidoyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 174558943 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-cyclopropyl-6-[(3R)-3-(methylamino)butanimidoyl]pyrimidin-4-amine |
| SMILES | [H]/N=C(\C[C@@H](C)NC)c1cc(NC2CC2)ncn1 |
| InChI | InChI=1S/C12H19N5/c1-8(14-2)5-10(13)11-6-12(16-7-15-11)17-9-3-4-9/h6-9,13-14H,3-5H2,1-2H3,(H,15,16,17)/b13-10+/t8-/m1/s1 |
| InChIKey | WBMKAMPHIFCANP-JSGDOSECSA-N |
| XLogP | 1.42 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|