C16H23N5O3 — CID 175892409
6-[[1-(4-methyl-2-oxopentanoyl)piperidin-4-yl]amino]pyrimidine-4-carboxamide (PubChem CID 175892409) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 6-[[1-(4-methyl-2-oxopentanoyl)piperidin-4-yl]amino]pyrimidine-4-carboxamide.
| Compound Name | 6-[[1-(4-methyl-2-oxopentanoyl)piperidin-4-yl]amino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 175892409 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 6-[[1-(4-methyl-2-oxopentanoyl)piperidin-4-yl]amino]pyrimidine-4-carboxamide |
| SMILES | CC(C)CC(=O)C(=O)N1CCC(Nc2cc(C(N)=O)ncn2)CC1 |
| InChI | InChI=1S/C16H23N5O3/c1-10(2)7-13(22)16(24)21-5-3-11(4-6-21)20-14-8-12(15(17)23)18-9-19-14/h8-11H,3-7H2,1-2H3,(H2,17,23)(H,18,19,20) |
| InChIKey | VYVXIEUOAPPEOS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|