C9H14 — CID 123654012
2-methylocta-3,4,5-triene (PubChem CID 123654012) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is 2-methylocta-3,4,5-triene.
| Compound Name | 2-methylocta-3,4,5-triene |
|---|---|
| PubChem CID | 123654012 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 2-methylocta-3,4,5-triene |
| SMILES | CCC=C=C=CC(C)C |
| InChI | InChI=1S/C9H14/c1-4-5-6-7-8-9(2)3/h5,8-9H,4H2,1-3H3/b8-5+ |
| InChIKey | CGJFTTHXRBZFBD-VMPITWQZSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |