C12H22 — CID 123960916
6,7-dimethyldeca-3,4-diene (PubChem CID 123960916) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 6,7-dimethyldeca-3,4-diene.
| Compound Name | 6,7-dimethyldeca-3,4-diene |
|---|---|
| PubChem CID | 123960916 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 6,7-dimethyldeca-3,4-diene |
| SMILES | CCC=C=CC(C)C(C)CCC |
| InChI | InChI=1S/C12H22/c1-5-7-8-10-12(4)11(3)9-6-2/h7,10-12H,5-6,9H2,1-4H3 |
| InChIKey | RZGMFOGRXNGPNE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |