C15H28 — CID 123744069
8-ethyl-9-methyldodeca-4,5-diene (PubChem CID 123744069) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 8-ethyl-9-methyldodeca-4,5-diene.
| Compound Name | 8-ethyl-9-methyldodeca-4,5-diene |
|---|---|
| PubChem CID | 123744069 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 8-ethyl-9-methyldodeca-4,5-diene |
| SMILES | CCCC=C=CCC(CC)C(C)CCC |
| InChI | InChI=1S/C15H28/c1-5-8-9-10-11-13-15(7-3)14(4)12-6-2/h9,11,14-15H,5-8,12-13H2,1-4H3 |
| InChIKey | WDRUWORHAHWVII-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |