C13H26N2 — CID 123787357
1-(7,8-dimethyldeca-3,4-dienyl)-2-methylhydrazine (PubChem CID 123787357) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-(7,8-dimethyldeca-3,4-dienyl)-2-methylhydrazine.
| Compound Name | 1-(7,8-dimethyldeca-3,4-dienyl)-2-methylhydrazine |
|---|---|
| PubChem CID | 123787357 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-(7,8-dimethyldeca-3,4-dienyl)-2-methylhydrazine |
| SMILES | CCC(C)C(C)CC=C=CCCNNC |
| InChI | InChI=1S/C13H26N2/c1-5-12(2)13(3)10-8-6-7-9-11-15-14-4/h7-8,12-15H,5,9-11H2,1-4H3 |
| InChIKey | BXOIGUCOWZTGRE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|