C10H23N — CID 163950897
3-ethyl-N,4-dimethylhexan-2-amine (PubChem CID 163950897) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is 3-ethyl-N,4-dimethylhexan-2-amine.
| Compound Name | 3-ethyl-N,4-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 163950897 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | 3-ethyl-N,4-dimethylhexan-2-amine |
| SMILES | CCC(C)C(CC)C(C)NC |
| InChI | InChI=1S/C10H23N/c1-6-8(3)10(7-2)9(4)11-5/h8-11H,6-7H2,1-5H3 |
| InChIKey | RZFJYSYLEZLGSZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |