C10H17F3 — CID 174009478
(E,5R,6R)-1,1,1-trifluoro-5,6-dimethyloct-2-ene (PubChem CID 174009478) has the molecular formula C10H17F3 and a molecular weight of 194.24 g/mol. Its IUPAC name is (E,5R,6R)-1,1,1-trifluoro-5,6-dimethyloct-2-ene.
| Compound Name | (E,5R,6R)-1,1,1-trifluoro-5,6-dimethyloct-2-ene |
|---|---|
| PubChem CID | 174009478 |
| Molecular Formula | C10H17F3 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (E,5R,6R)-1,1,1-trifluoro-5,6-dimethyloct-2-ene |
| SMILES | CC[C@@H](C)[C@H](C)C/C=C/C(F)(F)F |
| InChI | InChI=1S/C10H17F3/c1-4-8(2)9(3)6-5-7-10(11,12)13/h5,7-9H,4,6H2,1-3H3/b7-5+/t8-,9-/m1/s1 |
| InChIKey | HOXHLWIEKMWIKW-LKJMDQPVSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|