C16H23N3O3 — CID 123655172
4-anilino-4-(2-hydroxy-3,3-dimethylbutyl)imino-2-iminobutanoic acid (PubChem CID 123655172) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-anilino-4-(2-hydroxy-3,3-dimethylbutyl)imino-2-iminobutanoic acid.
| Compound Name | 4-anilino-4-(2-hydroxy-3,3-dimethylbutyl)imino-2-iminobutanoic acid |
|---|---|
| PubChem CID | 123655172 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 4-anilino-4-(2-hydroxy-3,3-dimethylbutyl)imino-2-iminobutanoic acid |
| SMILES | [H]/N=C(/C/C(=N\CC(O)C(C)(C)C)Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H23N3O3/c1-16(2,3)13(20)10-18-14(9-12(17)15(21)22)19-11-7-5-4-6-8-11/h4-8,13,17,20H,9-10H2,1-3H3,(H,18,19)(H,21,22)/b17-12- |
| InChIKey | WEYKRQJMLOUAMD-ATVHPVEESA-N |
| XLogP | 2.40 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|