C13H19N5OS — CID 83082439
(3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082439) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082439 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCC(C)(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H19N5OS/c1-13(2,8-20-12(16)18-11(14)15)10(19)17-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,17,19)(H5,14,15,16,18) |
| InChIKey | LDRHNRVEOIRHII-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|