About (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate
(3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082439) has the molecular formula C13H19N5OS
and a molecular weight of 293.40 g/mol. Its IUPAC name is (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate.
Molecular Properties
| Compound Name | (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate |
| PubChem CID | 83082439 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCC(C)(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H19N5OS/c1-13(2,8-20-12(16)18-11(14)15)10(19)17-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,17,19)(H5,14,15,16,18) |
| InChIKey | LDRHNRVEOIRHII-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate?
The IUPAC name of (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate (CID 83082439) is (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate.
What is the SMILES notation for (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate?
The canonical SMILES for (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate is [H]/N=C(\N=C(N)N)SCC(C)(C)C(=O)Nc1ccccc1.
What is the InChIKey of (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate?
The InChIKey is LDRHNRVEOIRHII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5OS/c1-13(2,8-20-12(16)18-11(14)15)10(19)17-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,17,19)(H5,14,15,16,18).
What are the key properties of (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate?
(3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate has a molecular weight of 293.40 g/mol, XLogP of 1.59, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-anilino-2,2-dimethyl-3-oxopropyl) N-(diaminomethylidene)carbamimidothioate is sourced from PubChem (CID 83082439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).