C23H28N6 — CID 123655275
4-[5-(6-azaspiro[2.5]octan-6-yl)-2-(pyrrolidin-3-ylmethylamino)pyrimidin-4-yl]benzonitrile (PubChem CID 123655275) has the molecular formula C23H28N6 and a molecular weight of 388.52 g/mol. Its IUPAC name is 4-[5-(6-azaspiro[2.5]octan-6-yl)-2-(pyrrolidin-3-ylmethylamino)pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[5-(6-azaspiro[2.5]octan-6-yl)-2-(pyrrolidin-3-ylmethylamino)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 123655275 |
| Molecular Formula | C23H28N6 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 4-[5-(6-azaspiro[2.5]octan-6-yl)-2-(pyrrolidin-3-ylmethylamino)pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(NCC3CCNC3)ncc2N2CCC3(CC2)CC3)cc1 |
| InChI | InChI=1S/C23H28N6/c24-13-17-1-3-19(4-2-17)21-20(29-11-8-23(6-7-23)9-12-29)16-27-22(28-21)26-15-18-5-10-25-14-18/h1-4,16,18,25H,5-12,14-15H2,(H,26,27,28) |
| InChIKey | ZUINOOGAQUPFPY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |