C8H13N3O — CID 22560251
N-(pyrrolidin-3-ylmethyl)-1,3-oxazol-4-amine (PubChem CID 22560251) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is N-(pyrrolidin-3-ylmethyl)-1,3-oxazol-4-amine.
| Compound Name | N-(pyrrolidin-3-ylmethyl)-1,3-oxazol-4-amine |
|---|---|
| PubChem CID | 22560251 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-(pyrrolidin-3-ylmethyl)-1,3-oxazol-4-amine |
| SMILES | c1nc(NCC2CCNC2)co1 |
| InChI | InChI=1S/C8H13N3O/c1-2-9-3-7(1)4-10-8-5-12-6-11-8/h5-7,9-10H,1-4H2 |
| InChIKey | NOKDQVXMLJIYTD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |