C17H36 — CID 123655302
6-ethyl-3,4-dimethyl-4-propyldecane (PubChem CID 123655302) has the molecular formula C17H36 and a molecular weight of 240.47 g/mol. Its IUPAC name is 6-ethyl-3,4-dimethyl-4-propyldecane.
| Compound Name | 6-ethyl-3,4-dimethyl-4-propyldecane |
|---|---|
| PubChem CID | 123655302 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 6-ethyl-3,4-dimethyl-4-propyldecane |
| SMILES | CCCCC(CC)CC(C)(CCC)C(C)CC |
| InChI | InChI=1S/C17H36/c1-7-11-12-16(10-4)14-17(6,13-8-2)15(5)9-3/h15-16H,7-14H2,1-6H3 |
| InChIKey | XCXWRCXVEACDJY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |