C19H41OP — CID 140650153
5,9-diethyl-7-(1-phosphanylethyl)tridecan-7-ol (PubChem CID 140650153) has the molecular formula C19H41OP and a molecular weight of 316.51 g/mol. Its IUPAC name is 5,9-diethyl-7-(1-phosphanylethyl)tridecan-7-ol.
| Compound Name | 5,9-diethyl-7-(1-phosphanylethyl)tridecan-7-ol |
|---|---|
| PubChem CID | 140650153 |
| Molecular Formula | C19H41OP |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | 5,9-diethyl-7-(1-phosphanylethyl)tridecan-7-ol |
| SMILES | CCCCC(CC)CC(O)(CC(CC)CCCC)C(C)P |
| InChI | InChI=1S/C19H41OP/c1-6-10-12-17(8-3)14-19(20,16(5)21)15-18(9-4)13-11-7-2/h16-18,20H,6-15,21H2,1-5H3 |
| InChIKey | DQCKDCKUQVEBAL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|