C14H28N2 — CID 123656866
4-ethyl-2-propan-2-yl-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine (PubChem CID 123656866) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 4-ethyl-2-propan-2-yl-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine.
| Compound Name | 4-ethyl-2-propan-2-yl-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 123656866 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 4-ethyl-2-propan-2-yl-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine |
| SMILES | CCC1CN(C(C)C)CC2CCCCN2C1 |
| InChI | InChI=1S/C14H28N2/c1-4-13-9-15-8-6-5-7-14(15)11-16(10-13)12(2)3/h12-14H,4-11H2,1-3H3 |
| InChIKey | CLDOHKAHYUNVPH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |