C16H20F4O — CID 123657506
5-[1-(3,4-difluorophenyl)-3,3-difluorobutan-2-yl]-2-methyloxane (PubChem CID 123657506) has the molecular formula C16H20F4O and a molecular weight of 304.33 g/mol. Its IUPAC name is 5-[1-(3,4-difluorophenyl)-3,3-difluorobutan-2-yl]-2-methyloxane.
| Compound Name | 5-[1-(3,4-difluorophenyl)-3,3-difluorobutan-2-yl]-2-methyloxane |
|---|---|
| PubChem CID | 123657506 |
| Molecular Formula | C16H20F4O |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 5-[1-(3,4-difluorophenyl)-3,3-difluorobutan-2-yl]-2-methyloxane |
| SMILES | CC1CCC(C(Cc2ccc(F)c(F)c2)C(C)(F)F)CO1 |
| InChI | InChI=1S/C16H20F4O/c1-10-3-5-12(9-21-10)13(16(2,19)20)7-11-4-6-14(17)15(18)8-11/h4,6,8,10,12-13H,3,5,7,9H2,1-2H3 |
| InChIKey | FVPCWTALRWJURJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |