C38H76 — CID 123658448
1-methyl-2-pentyl-3-(2,11,12,14-tetraethyl-3,6,7,15-tetramethylhexadecyl)cyclobutane (PubChem CID 123658448) has the molecular formula C38H76 and a molecular weight of 533.03 g/mol. Its IUPAC name is 1-methyl-2-pentyl-3-(2,11,12,14-tetraethyl-3,6,7,15-tetramethylhexadecyl)cyclobutane.
| Compound Name | 1-methyl-2-pentyl-3-(2,11,12,14-tetraethyl-3,6,7,15-tetramethylhexadecyl)cyclobutane |
|---|---|
| PubChem CID | 123658448 |
| Molecular Formula | C38H76 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.59 |
| IUPAC Name | 1-methyl-2-pentyl-3-(2,11,12,14-tetraethyl-3,6,7,15-tetramethylhexadecyl)cyclobutane |
| SMILES | CCCCCC1C(C)CC1CC(CC)C(C)CCC(C)C(C)CCCC(CC)C(CC)CC(CC)C(C)C |
| InChI | InChI=1S/C38H76/c1-12-17-18-22-38-32(11)25-37(38)27-35(15-4)31(10)24-23-30(9)29(8)20-19-21-33(13-2)36(16-5)26-34(14-3)28(6)7/h28-38H,12-27H2,1-11H3 |
| InChIKey | XKVZOVBEOYJKSA-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|