About 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane
1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane (PubChem CID 91456729) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane.
Analyze 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane?
The IUPAC name of 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane (CID 91456729) is 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane.
What is the SMILES notation for 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane?
The canonical SMILES for 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane is CCC(CC1CC(C)C1C)C(C)C.
What is the InChIKey of 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane?
The InChIKey is CHOQDEBYVQKBSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26/c1-6-12(9(2)3)8-13-7-10(4)11(13)5/h9-13H,6-8H2,1-5H3.
What are the key properties of 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane?
1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane has a molecular weight of 182.35 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethyl-3-methylbutyl)-2,3-dimethylcyclobutane is sourced from PubChem (CID 91456729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).