C11H20S — CID 123659273
6-methyl-4-pentyl-3,4-dihydro-2H-thiopyran (PubChem CID 123659273) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is 6-methyl-4-pentyl-3,4-dihydro-2H-thiopyran.
| Compound Name | 6-methyl-4-pentyl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 123659273 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 6-methyl-4-pentyl-3,4-dihydro-2H-thiopyran |
| SMILES | CCCCCC1C=C(C)SCC1 |
| InChI | InChI=1S/C11H20S/c1-3-4-5-6-11-7-8-12-10(2)9-11/h9,11H,3-8H2,1-2H3 |
| InChIKey | XFHVCTNQYUKAJH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|