C25H41N3 — CID 123659886
4-[3-(4-aminopentyl)-6,7-dimethylcyclohepta-1,3,6-trien-1-yl]-N',3-dimethyl-2-propylidenehex-3-enimidamide (PubChem CID 123659886) has the molecular formula C25H41N3 and a molecular weight of 383.62 g/mol. Its IUPAC name is 4-[3-(4-aminopentyl)-6,7-dimethylcyclohepta-1,3,6-trien-1-yl]-N',3-dimethyl-2-propylidenehex-3-enimidamide.
| Compound Name | 4-[3-(4-aminopentyl)-6,7-dimethylcyclohepta-1,3,6-trien-1-yl]-N',3-dimethyl-2-propylidenehex-3-enimidamide |
|---|---|
| PubChem CID | 123659886 |
| Molecular Formula | C25H41N3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.33 |
| IUPAC Name | 4-[3-(4-aminopentyl)-6,7-dimethylcyclohepta-1,3,6-trien-1-yl]-N',3-dimethyl-2-propylidenehex-3-enimidamide |
| SMILES | CCC=C(C(C)=C(CC)C1=CC(CCCC(C)N)=CCC(C)=C1C)/C(N)=N/C |
| InChI | InChI=1S/C25H41N3/c1-8-11-23(25(27)28-7)20(6)22(9-2)24-16-21(13-10-12-18(4)26)15-14-17(3)19(24)5/h11,15-16,18H,8-10,12-14,26H2,1-7H3,(H2,27,28) |
| InChIKey | ZCCCSPQBAMLDMX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|