C11H16N2 — CID 142244110
2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 142244110) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 142244110 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | C=C/C=C\C=C(/C)C1CCC(N)=N1 |
| InChI | InChI=1S/C11H16N2/c1-3-4-5-6-9(2)10-7-8-11(12)13-10/h3-6,10H,1,7-8H2,2H3,(H2,12,13)/b5-4-,9-6+ |
| InChIKey | ZAAISMFVBMXOPZ-KMOPYBJPSA-N |
| XLogP | 2.19 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|