About 2-methyliminobutanamide
2-methyliminobutanamide (PubChem CID 123659925) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 2-methyliminobutanamide.
Molecular Properties
| Compound Name | 2-methyliminobutanamide |
| PubChem CID | 123659925 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 2-methyliminobutanamide |
| SMILES | CC/C(=N\C)C(N)=O |
| InChI | InChI=1S/C5H10N2O/c1-3-4(7-2)5(6)8/h3H2,1-2H3,(H2,6,8)/b7-4+ |
| InChIKey | AQGMOWDVXMACPS-QPJJXVBHSA-N |
| XLogP | -0.05 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyliminobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyliminobutanamide?
The IUPAC name of 2-methyliminobutanamide (CID 123659925) is 2-methyliminobutanamide.
What is the SMILES notation for 2-methyliminobutanamide?
The canonical SMILES for 2-methyliminobutanamide is CC/C(=N\C)C(N)=O.
What is the InChIKey of 2-methyliminobutanamide?
The InChIKey is AQGMOWDVXMACPS-QPJJXVBHSA-N. The full InChI is InChI=1S/C5H10N2O/c1-3-4(7-2)5(6)8/h3H2,1-2H3,(H2,6,8)/b7-4+.
What are the key properties of 2-methyliminobutanamide?
2-methyliminobutanamide has a molecular weight of 114.15 g/mol, XLogP of -0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyliminobutanamide is sourced from PubChem (CID 123659925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).