C25H19ClN6O2 — CID 123660458
(Z)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-1-(3-hydroxyazetidin-1-yl)-2-isocyanoprop-2-en-1-one (PubChem CID 123660458) has the molecular formula C25H19ClN6O2 and a molecular weight of 470.92 g/mol. Its IUPAC name is (Z)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-1-(3-hydroxyazetidin-1-yl)-2-isocyanoprop-2-en-1-one.
| Compound Name | (Z)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-1-(3-hydroxyazetidin-1-yl)-2-isocyanoprop-2-en-1-one |
|---|---|
| PubChem CID | 123660458 |
| Molecular Formula | C25H19ClN6O2 |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (Z)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-1-(3-hydroxyazetidin-1-yl)-2-isocyanoprop-2-en-1-one |
| SMILES | [C-]#[N+]/C(=C\c1cccc(-n2cc(-c3ccc(Cl)cc3)c3c(N)ncnc32)c1)C(=O)N1CC(O)C1 |
| InChI | InChI=1S/C25H19ClN6O2/c1-28-21(25(34)31-11-19(33)12-31)10-15-3-2-4-18(9-15)32-13-20(16-5-7-17(26)8-6-16)22-23(27)29-14-30-24(22)32/h2-10,13-14,19,33H,11-12H2,(H2,27,29,30)/b21-10- |
| InChIKey | GDHWPMWMJAGBTF-FBHDLOMBSA-N |
| XLogP | 3.79 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|