C13H26 — CID 123660607
4,5-dimethylheptan-2-ylcyclobutane (PubChem CID 123660607) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is 4,5-dimethylheptan-2-ylcyclobutane.
| Compound Name | 4,5-dimethylheptan-2-ylcyclobutane |
|---|---|
| PubChem CID | 123660607 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 4,5-dimethylheptan-2-ylcyclobutane |
| SMILES | CCC(C)C(C)CC(C)C1CCC1 |
| InChI | InChI=1S/C13H26/c1-5-10(2)11(3)9-12(4)13-7-6-8-13/h10-13H,5-9H2,1-4H3 |
| InChIKey | QMZJKHDUNGJMTD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |