About 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane
1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane (PubChem CID 123406141) has the molecular formula C21H42
and a molecular weight of 294.57 g/mol. Its IUPAC name is 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane.
Molecular Properties
| Compound Name | 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane |
| PubChem CID | 123406141 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane |
| SMILES | CCC(C)C(C)CCC(C)C1CCCCC(C)CCCC1 |
| InChI | InChI=1S/C21H42/c1-6-18(3)19(4)15-16-20(5)21-13-9-7-11-17(2)12-8-10-14-21/h17-21H,6-16H2,1-5H3 |
| InChIKey | CPADUMPRAGOELB-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane?
The IUPAC name of 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane (CID 123406141) is 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane.
What is the SMILES notation for 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane?
The canonical SMILES for 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane is CCC(C)C(C)CCC(C)C1CCCCC(C)CCCC1.
What is the InChIKey of 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane?
The InChIKey is CPADUMPRAGOELB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42/c1-6-18(3)19(4)15-16-20(5)21-13-9-7-11-17(2)12-8-10-14-21/h17-21H,6-16H2,1-5H3.
What are the key properties of 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane?
1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane has a molecular weight of 294.57 g/mol, XLogP of 7.47, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dimethyloctan-2-yl)-6-methylcyclodecane is sourced from PubChem (CID 123406141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).