C29H32FN2O4+ — CID 123660940
oxan-2-ylmethyl 3-[2-(aminomethyl)-5-[3-(3-fluoro-1-methylpyridin-1-ium-4-yl)propanoyl]phenyl]benzoate (PubChem CID 123660940) has the molecular formula C29H32FN2O4+ and a molecular weight of 491.58 g/mol. Its IUPAC name is oxan-2-ylmethyl 3-[2-(aminomethyl)-5-[3-(3-fluoro-1-methylpyridin-1-ium-4-yl)propanoyl]phenyl]benzoate.
| Compound Name | oxan-2-ylmethyl 3-[2-(aminomethyl)-5-[3-(3-fluoro-1-methylpyridin-1-ium-4-yl)propanoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 123660940 |
| Molecular Formula | C29H32FN2O4+ |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | oxan-2-ylmethyl 3-[2-(aminomethyl)-5-[3-(3-fluoro-1-methylpyridin-1-ium-4-yl)propanoyl]phenyl]benzoate |
| SMILES | C[n+]1ccc(CCC(=O)c2ccc(CN)c(-c3cccc(C(=O)OCC4CCCCO4)c3)c2)c(F)c1 |
| InChI | InChI=1S/C29H32FN2O4/c1-32-13-12-20(27(30)18-32)10-11-28(33)22-8-9-24(17-31)26(16-22)21-5-4-6-23(15-21)29(34)36-19-25-7-2-3-14-35-25/h4-6,8-9,12-13,15-16,18,25H,2-3,7,10-11,14,17,19,31H2,1H3/q+1 |
| InChIKey | RKRXXFSHHINRMX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|