About carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate
carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate (PubChem CID 123662885) has the molecular formula C21H24O9
and a molecular weight of 420.41 g/mol. Its IUPAC name is carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate.
Molecular Properties
| Compound Name | carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate |
| PubChem CID | 123662885 |
| Molecular Formula | C21H24O9 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)c(OCCCOc2cc(O)c(C)cc2OC)cc1O.O=C=O |
| InChI | InChI=1S/C20H24O7.CO2/c1-12-9-18(24-3)19(10-15(12)21)27-7-5-6-26-17-11-16(22)14(8-13(17)2)20(23)25-4;2-1-3/h8-11,21-22H,5-7H2,1-4H3; |
| InChIKey | OFZYIGYBCIYDKC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate?
The IUPAC name of carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate (CID 123662885) is carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate.
What is the SMILES notation for carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate?
The canonical SMILES for carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate is COC(=O)c1cc(C)c(OCCCOc2cc(O)c(C)cc2OC)cc1O.O=C=O.
What is the InChIKey of carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate?
The InChIKey is OFZYIGYBCIYDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O7.CO2/c1-12-9-18(24-3)19(10-15(12)21)27-7-5-6-26-17-11-16(22)14(8-13(17)2)20(23)25-4;2-1-3/h8-11,21-22H,5-7H2,1-4H3;.
What are the key properties of carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate?
carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate has a molecular weight of 420.41 g/mol, XLogP of 2.77, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;methyl 2-hydroxy-4-[3-(5-hydroxy-2-methoxy-4-methylphenoxy)propoxy]-5-methylbenzoate is sourced from PubChem (CID 123662885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).