C21H20N2O5S2 — CID 123663589
4-[4-[[3-hydroxy-6-(methylsulfonylmethyl)-4-sulfanylidenepyran-2-yl]methylamino]phenyl]benzamide (PubChem CID 123663589) has the molecular formula C21H20N2O5S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-[4-[[3-hydroxy-6-(methylsulfonylmethyl)-4-sulfanylidenepyran-2-yl]methylamino]phenyl]benzamide.
| Compound Name | 4-[4-[[3-hydroxy-6-(methylsulfonylmethyl)-4-sulfanylidenepyran-2-yl]methylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 123663589 |
| Molecular Formula | C21H20N2O5S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 4-[4-[[3-hydroxy-6-(methylsulfonylmethyl)-4-sulfanylidenepyran-2-yl]methylamino]phenyl]benzamide |
| SMILES | CS(=O)(=O)Cc1cc(=S)c(O)c(CNc2ccc(-c3ccc(C(N)=O)cc3)cc2)o1 |
| InChI | InChI=1S/C21H20N2O5S2/c1-30(26,27)12-17-10-19(29)20(24)18(28-17)11-23-16-8-6-14(7-9-16)13-2-4-15(5-3-13)21(22)25/h2-10,23-24H,11-12H2,1H3,(H2,22,25) |
| InChIKey | VZPWGEYLHCBKGZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|