C25H30N2O6S — CID 118146961
3-hydroxy-6-(methylsulfonylmethyl)-2-[[4-[4-(2-propoxyethylamino)phenyl]anilino]methyl]pyran-4-one (PubChem CID 118146961) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is 3-hydroxy-6-(methylsulfonylmethyl)-2-[[4-[4-(2-propoxyethylamino)phenyl]anilino]methyl]pyran-4-one.
| Compound Name | 3-hydroxy-6-(methylsulfonylmethyl)-2-[[4-[4-(2-propoxyethylamino)phenyl]anilino]methyl]pyran-4-one |
|---|---|
| PubChem CID | 118146961 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-hydroxy-6-(methylsulfonylmethyl)-2-[[4-[4-(2-propoxyethylamino)phenyl]anilino]methyl]pyran-4-one |
| SMILES | CCCOCCNc1ccc(-c2ccc(NCc3oc(CS(C)(=O)=O)cc(=O)c3O)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O6S/c1-3-13-32-14-12-26-20-8-4-18(5-9-20)19-6-10-21(11-7-19)27-16-24-25(29)23(28)15-22(33-24)17-34(2,30)31/h4-11,15,26-27,29H,3,12-14,16-17H2,1-2H3 |
| InChIKey | FOMUDOVVPJZFOO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|