C25H27NO5S — CID 123599928
3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-pentanoylphenyl)anilino]methyl]pyran-4-one (PubChem CID 123599928) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is 3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-pentanoylphenyl)anilino]methyl]pyran-4-one.
| Compound Name | 3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-pentanoylphenyl)anilino]methyl]pyran-4-one |
|---|---|
| PubChem CID | 123599928 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-pentanoylphenyl)anilino]methyl]pyran-4-one |
| SMILES | CCCCC(=O)c1ccc(-c2ccc(NCc3oc(CS(C)=O)cc(=O)c3O)cc2)cc1 |
| InChI | InChI=1S/C25H27NO5S/c1-3-4-5-22(27)19-8-6-17(7-9-19)18-10-12-20(13-11-18)26-15-24-25(29)23(28)14-21(31-24)16-32(2)30/h6-14,26,29H,3-5,15-16H2,1-2H3 |
| InChIKey | JVAOOJKBPSXBBZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |